C13H14F2OS — CID 55178865
2-cyclopentylsulfanyl-1-(2,4-difluorophenyl)ethanone (PubChem CID 55178865) has the molecular formula C13H14F2OS and a molecular weight of 256.32 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-1-(2,4-difluorophenyl)ethanone.
| Compound Name | 2-cyclopentylsulfanyl-1-(2,4-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 55178865 |
| Molecular Formula | C13H14F2OS |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-cyclopentylsulfanyl-1-(2,4-difluorophenyl)ethanone |
| SMILES | O=C(CSC1CCCC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H14F2OS/c14-9-5-6-11(12(15)7-9)13(16)8-17-10-3-1-2-4-10/h5-7,10H,1-4,8H2 |
| InChIKey | RFIJLXFWGMRLLQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |