C15H18F2OS — CID 60698486
2-cyclohexylsulfanyl-1-(2,4-difluorophenyl)propan-1-one (PubChem CID 60698486) has the molecular formula C15H18F2OS and a molecular weight of 284.37 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-1-(2,4-difluorophenyl)propan-1-one.
| Compound Name | 2-cyclohexylsulfanyl-1-(2,4-difluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 60698486 |
| Molecular Formula | C15H18F2OS |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-cyclohexylsulfanyl-1-(2,4-difluorophenyl)propan-1-one |
| SMILES | CC(SC1CCCCC1)C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H18F2OS/c1-10(19-12-5-3-2-4-6-12)15(18)13-8-7-11(16)9-14(13)17/h7-10,12H,2-6H2,1H3 |
| InChIKey | QRQOHYXUEAYCOM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |