C19H17FN2O3 — CID 90574329
N-[2-[4-(2-fluorophenoxy)but-2-ynylamino]-2-oxoethyl]benzamide (PubChem CID 90574329) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is N-[2-[4-(2-fluorophenoxy)but-2-ynylamino]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[4-(2-fluorophenoxy)but-2-ynylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 90574329 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-[2-[4-(2-fluorophenoxy)but-2-ynylamino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1)NCC#CCOc1ccccc1F |
| InChI | InChI=1S/C19H17FN2O3/c20-16-10-4-5-11-17(16)25-13-7-6-12-21-18(23)14-22-19(24)15-8-2-1-3-9-15/h1-5,8-11H,12-14H2,(H,21,23)(H,22,24) |
| InChIKey | FBKQURFFLWPQGP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|