C15H13FN2O2S — CID 90574343
N-[4-(2-fluorophenoxy)but-2-ynyl]-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 90574343) has the molecular formula C15H13FN2O2S and a molecular weight of 304.35 g/mol. Its IUPAC name is N-[4-(2-fluorophenoxy)but-2-ynyl]-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-(2-fluorophenoxy)but-2-ynyl]-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 90574343 |
| Molecular Formula | C15H13FN2O2S |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N-[4-(2-fluorophenoxy)but-2-ynyl]-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)NCC#CCOc2ccccc2F)cs1 |
| InChI | InChI=1S/C15H13FN2O2S/c1-11-18-13(10-21-11)15(19)17-8-4-5-9-20-14-7-3-2-6-12(14)16/h2-3,6-7,10H,8-9H2,1H3,(H,17,19) |
| InChIKey | MUPQSDVCEZUAAX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|