C16H15FN2O2S — CID 90574533
N-[4-(2-fluorophenoxy)but-2-ynyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 90574533) has the molecular formula C16H15FN2O2S and a molecular weight of 318.37 g/mol. Its IUPAC name is N-[4-(2-fluorophenoxy)but-2-ynyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[4-(2-fluorophenoxy)but-2-ynyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 90574533 |
| Molecular Formula | C16H15FN2O2S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-[4-(2-fluorophenoxy)but-2-ynyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)NCC#CCOc2ccccc2F)s1 |
| InChI | InChI=1S/C16H15FN2O2S/c1-11-15(22-12(2)19-11)16(20)18-9-5-6-10-21-14-8-4-3-7-13(14)17/h3-4,7-8H,9-10H2,1-2H3,(H,18,20) |
| InChIKey | NOVGWSKOFBOKGI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|