C22H23NO6S — CID 90578753
methyl 4-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynylsulfamoyl]benzoate (PubChem CID 90578753) has the molecular formula C22H23NO6S and a molecular weight of 429.49 g/mol. Its IUPAC name is methyl 4-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynylsulfamoyl]benzoate.
| Compound Name | methyl 4-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 90578753 |
| Molecular Formula | C22H23NO6S |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | methyl 4-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynylsulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCC#CCOc2cccc3c2OC(C)(C)C3)cc1 |
| InChI | InChI=1S/C22H23NO6S/c1-22(2)15-17-7-6-8-19(20(17)29-22)28-14-5-4-13-23-30(25,26)18-11-9-16(10-12-18)21(24)27-3/h6-12,23H,13-15H2,1-3H3 |
| InChIKey | FBFUHSMNHIXFHB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|