C21H20F3NO5S — CID 90578727
N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 90578727) has the molecular formula C21H20F3NO5S and a molecular weight of 455.45 g/mol. Its IUPAC name is N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 90578727 |
| Molecular Formula | C21H20F3NO5S |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CC1(C)Cc2cccc(OCC#CCNS(=O)(=O)c3ccc(OC(F)(F)F)cc3)c2O1 |
| InChI | InChI=1S/C21H20F3NO5S/c1-20(2)14-15-6-5-7-18(19(15)30-20)28-13-4-3-12-25-31(26,27)17-10-8-16(9-11-17)29-21(22,23)24/h5-11,25H,12-14H2,1-2H3 |
| InChIKey | RHKTYVGYQZWIDI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|