C21H22FNO5S — CID 90578714
N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-5-fluoro-2-methoxybenzenesulfonamide (PubChem CID 90578714) has the molecular formula C21H22FNO5S and a molecular weight of 419.47 g/mol. Its IUPAC name is N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-5-fluoro-2-methoxybenzenesulfonamide.
| Compound Name | N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-5-fluoro-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 90578714 |
| Molecular Formula | C21H22FNO5S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-5-fluoro-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(F)cc1S(=O)(=O)NCC#CCOc1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C21H22FNO5S/c1-21(2)14-15-7-6-8-18(20(15)28-21)27-12-5-4-11-23-29(24,25)19-13-16(22)9-10-17(19)26-3/h6-10,13,23H,11-12,14H2,1-3H3 |
| InChIKey | BJKAQFMVZYSANH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|