C17H13ClF3NO3S — CID 90575054
N-[4-(2-chlorophenoxy)but-2-ynyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 90575054) has the molecular formula C17H13ClF3NO3S and a molecular weight of 403.81 g/mol. Its IUPAC name is N-[4-(2-chlorophenoxy)but-2-ynyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-(2-chlorophenoxy)but-2-ynyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90575054 |
| Molecular Formula | C17H13ClF3NO3S |
| Molecular Weight | 403.81 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | N-[4-(2-chlorophenoxy)but-2-ynyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC#CCOc1ccccc1Cl)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13ClF3NO3S/c18-15-5-1-2-6-16(15)25-12-4-3-11-22-26(23,24)14-9-7-13(8-10-14)17(19,20)21/h1-2,5-10,22H,11-12H2 |
| InChIKey | OPNJISKNWDIGEP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.81 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|