C16H13ClFNO3S — CID 90552990
N-[3-(2-chlorophenyl)prop-2-ynyl]-5-fluoro-2-methoxybenzenesulfonamide (PubChem CID 90552990) has the molecular formula C16H13ClFNO3S and a molecular weight of 353.80 g/mol. Its IUPAC name is N-[3-(2-chlorophenyl)prop-2-ynyl]-5-fluoro-2-methoxybenzenesulfonamide.
| Compound Name | N-[3-(2-chlorophenyl)prop-2-ynyl]-5-fluoro-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 90552990 |
| Molecular Formula | C16H13ClFNO3S |
| Molecular Weight | 353.80 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | N-[3-(2-chlorophenyl)prop-2-ynyl]-5-fluoro-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(F)cc1S(=O)(=O)NCC#Cc1ccccc1Cl |
| InChI | InChI=1S/C16H13ClFNO3S/c1-22-15-9-8-13(18)11-16(15)23(20,21)19-10-4-6-12-5-2-3-7-14(12)17/h2-3,5,7-9,11,19H,10H2,1H3 |
| InChIKey | PDHOZVOAPNLBNI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.80 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|