C16H13Cl2NO2S — CID 90553007
3-chloro-N-[3-(2-chlorophenyl)prop-2-ynyl]-2-methylbenzenesulfonamide (PubChem CID 90553007) has the molecular formula C16H13Cl2NO2S and a molecular weight of 354.26 g/mol. Its IUPAC name is 3-chloro-N-[3-(2-chlorophenyl)prop-2-ynyl]-2-methylbenzenesulfonamide.
| Compound Name | 3-chloro-N-[3-(2-chlorophenyl)prop-2-ynyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 90553007 |
| Molecular Formula | C16H13Cl2NO2S |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 3-chloro-N-[3-(2-chlorophenyl)prop-2-ynyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)NCC#Cc1ccccc1Cl |
| InChI | InChI=1S/C16H13Cl2NO2S/c1-12-14(17)9-4-10-16(12)22(20,21)19-11-5-7-13-6-2-3-8-15(13)18/h2-4,6,8-10,19H,11H2,1H3 |
| InChIKey | HRFXSIWHLLJYFW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|