C19H19ClN2O3S — CID 90553597
4-[3-[(3-chloro-2-methylphenyl)sulfonylamino]prop-1-ynyl]-N,N-dimethylbenzamide (PubChem CID 90553597) has the molecular formula C19H19ClN2O3S and a molecular weight of 390.89 g/mol. Its IUPAC name is 4-[3-[(3-chloro-2-methylphenyl)sulfonylamino]prop-1-ynyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[3-[(3-chloro-2-methylphenyl)sulfonylamino]prop-1-ynyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 90553597 |
| Molecular Formula | C19H19ClN2O3S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 4-[3-[(3-chloro-2-methylphenyl)sulfonylamino]prop-1-ynyl]-N,N-dimethylbenzamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)NCC#Cc1ccc(C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C19H19ClN2O3S/c1-14-17(20)7-4-8-18(14)26(24,25)21-13-5-6-15-9-11-16(12-10-15)19(23)22(2)3/h4,7-12,21H,13H2,1-3H3 |
| InChIKey | GNPBLALDPNRZRF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|