C18H16F2N2O3S — CID 90553601
4-[3-[(2,6-difluorophenyl)sulfonylamino]prop-1-ynyl]-N,N-dimethylbenzamide (PubChem CID 90553601) has the molecular formula C18H16F2N2O3S and a molecular weight of 378.40 g/mol. Its IUPAC name is 4-[3-[(2,6-difluorophenyl)sulfonylamino]prop-1-ynyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[3-[(2,6-difluorophenyl)sulfonylamino]prop-1-ynyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 90553601 |
| Molecular Formula | C18H16F2N2O3S |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 4-[3-[(2,6-difluorophenyl)sulfonylamino]prop-1-ynyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(C#CCNS(=O)(=O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C18H16F2N2O3S/c1-22(2)18(23)14-10-8-13(9-11-14)5-4-12-21-26(24,25)17-15(19)6-3-7-16(17)20/h3,6-11,21H,12H2,1-2H3 |
| InChIKey | SHZRCGFWNCSVGN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|