C21H20N2O4 — CID 90549974
methyl 4-[3-[4-(dimethylcarbamoyl)phenyl]prop-2-ynylcarbamoyl]benzoate (PubChem CID 90549974) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is methyl 4-[3-[4-(dimethylcarbamoyl)phenyl]prop-2-ynylcarbamoyl]benzoate.
| Compound Name | methyl 4-[3-[4-(dimethylcarbamoyl)phenyl]prop-2-ynylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 90549974 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | methyl 4-[3-[4-(dimethylcarbamoyl)phenyl]prop-2-ynylcarbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NCC#Cc2ccc(C(=O)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H20N2O4/c1-23(2)20(25)17-8-6-15(7-9-17)5-4-14-22-19(24)16-10-12-18(13-11-16)21(26)27-3/h6-13H,14H2,1-3H3,(H,22,24) |
| InChIKey | OTGSPXYGIRBFCX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|