C21H16F6N2O2 — CID 90550067
N-[3-[4-(dimethylcarbamoyl)phenyl]prop-2-ynyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 90550067) has the molecular formula C21H16F6N2O2 and a molecular weight of 442.36 g/mol. Its IUPAC name is N-[3-[4-(dimethylcarbamoyl)phenyl]prop-2-ynyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[3-[4-(dimethylcarbamoyl)phenyl]prop-2-ynyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 90550067 |
| Molecular Formula | C21H16F6N2O2 |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | N-[3-[4-(dimethylcarbamoyl)phenyl]prop-2-ynyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CN(C)C(=O)c1ccc(C#CCNC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H16F6N2O2/c1-29(2)19(31)14-7-5-13(6-8-14)4-3-9-28-18(30)15-10-16(20(22,23)24)12-17(11-15)21(25,26)27/h5-8,10-12H,9H2,1-2H3,(H,28,30) |
| InChIKey | PBDORNITUSAJEL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|