C22H24N2O4 — CID 90550095
4-[3-[[2-(3,4-dimethoxyphenyl)acetyl]amino]prop-1-ynyl]-N,N-dimethylbenzamide (PubChem CID 90550095) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 4-[3-[[2-(3,4-dimethoxyphenyl)acetyl]amino]prop-1-ynyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[3-[[2-(3,4-dimethoxyphenyl)acetyl]amino]prop-1-ynyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 90550095 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-[3-[[2-(3,4-dimethoxyphenyl)acetyl]amino]prop-1-ynyl]-N,N-dimethylbenzamide |
| SMILES | COc1ccc(CC(=O)NCC#Cc2ccc(C(=O)N(C)C)cc2)cc1OC |
| InChI | InChI=1S/C22H24N2O4/c1-24(2)22(26)18-10-7-16(8-11-18)6-5-13-23-21(25)15-17-9-12-19(27-3)20(14-17)28-4/h7-12,14H,13,15H2,1-4H3,(H,23,25) |
| InChIKey | FDLMKIYUHKYUJW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|