C22H21N3O3S — CID 90553583
N,N-dimethyl-4-[3-[(2-methylquinolin-8-yl)sulfonylamino]prop-1-ynyl]benzamide (PubChem CID 90553583) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is N,N-dimethyl-4-[3-[(2-methylquinolin-8-yl)sulfonylamino]prop-1-ynyl]benzamide.
| Compound Name | N,N-dimethyl-4-[3-[(2-methylquinolin-8-yl)sulfonylamino]prop-1-ynyl]benzamide |
|---|---|
| PubChem CID | 90553583 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N,N-dimethyl-4-[3-[(2-methylquinolin-8-yl)sulfonylamino]prop-1-ynyl]benzamide |
| SMILES | Cc1ccc2cccc(S(=O)(=O)NCC#Cc3ccc(C(=O)N(C)C)cc3)c2n1 |
| InChI | InChI=1S/C22H21N3O3S/c1-16-9-12-18-7-4-8-20(21(18)24-16)29(27,28)23-15-5-6-17-10-13-19(14-11-17)22(26)25(2)3/h4,7-14,23H,15H2,1-3H3 |
| InChIKey | NSEVZZBJWFAEAH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|