C16H20N2O3S — CID 97244895
N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]-2-methylquinoline-8-sulfonamide (PubChem CID 97244895) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]-2-methylquinoline-8-sulfonamide.
| Compound Name | N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]-2-methylquinoline-8-sulfonamide |
|---|---|
| PubChem CID | 97244895 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]-2-methylquinoline-8-sulfonamide |
| SMILES | Cc1ccc2cccc(S(=O)(=O)NC[C@@H]3CCC[C@H]3O)c2n1 |
| InChI | InChI=1S/C16H20N2O3S/c1-11-8-9-12-4-3-7-15(16(12)18-11)22(20,21)17-10-13-5-2-6-14(13)19/h3-4,7-9,13-14,17,19H,2,5-6,10H2,1H3/t13-,14+/m0/s1 |
| InChIKey | DDSPRPACNFWPNX-UONOGXRCSA-N |
| XLogP | 1.98 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |