C15H17ClN2O3S — CID 97013728
8-chloro-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]quinoline-5-sulfonamide (PubChem CID 97013728) has the molecular formula C15H17ClN2O3S and a molecular weight of 340.83 g/mol. Its IUPAC name is 8-chloro-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]quinoline-5-sulfonamide.
| Compound Name | 8-chloro-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 97013728 |
| Molecular Formula | C15H17ClN2O3S |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 8-chloro-N-[[(1S,2R)-2-hydroxycyclopentyl]methyl]quinoline-5-sulfonamide |
| SMILES | O=S(=O)(NC[C@@H]1CCC[C@H]1O)c1ccc(Cl)c2ncccc12 |
| InChI | InChI=1S/C15H17ClN2O3S/c16-12-6-7-14(11-4-2-8-17-15(11)12)22(20,21)18-9-10-3-1-5-13(10)19/h2,4,6-8,10,13,18-19H,1,3,5,9H2/t10-,13+/m0/s1 |
| InChIKey | KOAXUMLVEGTJNG-GXFFZTMASA-N |
| XLogP | 2.33 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |