C15H19ClN4O2S — CID 54156973
8-chloro-N-(2-piperazin-1-ylethyl)quinoline-5-sulfonamide (PubChem CID 54156973) has the molecular formula C15H19ClN4O2S and a molecular weight of 354.86 g/mol. Its IUPAC name is 8-chloro-N-(2-piperazin-1-ylethyl)quinoline-5-sulfonamide.
| Compound Name | 8-chloro-N-(2-piperazin-1-ylethyl)quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 54156973 |
| Molecular Formula | C15H19ClN4O2S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 8-chloro-N-(2-piperazin-1-ylethyl)quinoline-5-sulfonamide |
| SMILES | O=S(=O)(NCCN1CCNCC1)c1ccc(Cl)c2ncccc12 |
| InChI | InChI=1S/C15H19ClN4O2S/c16-13-3-4-14(12-2-1-5-18-15(12)13)23(21,22)19-8-11-20-9-6-17-7-10-20/h1-5,17,19H,6-11H2 |
| InChIKey | OLTMVSRDYJSJDV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |