C16H22N4O2S — CID 54071162
N-[2-(1,4-diazepan-1-yl)ethyl]isoquinoline-5-sulfonamide (PubChem CID 54071162) has the molecular formula C16H22N4O2S and a molecular weight of 334.44 g/mol. Its IUPAC name is N-[2-(1,4-diazepan-1-yl)ethyl]isoquinoline-5-sulfonamide.
| Compound Name | N-[2-(1,4-diazepan-1-yl)ethyl]isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 54071162 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-[2-(1,4-diazepan-1-yl)ethyl]isoquinoline-5-sulfonamide |
| SMILES | O=S(=O)(NCCN1CCCNCC1)c1cccc2cnccc12 |
| InChI | InChI=1S/C16H22N4O2S/c21-23(22,19-9-12-20-10-2-6-17-8-11-20)16-4-1-3-14-13-18-7-5-15(14)16/h1,3-5,7,13,17,19H,2,6,8-12H2 |
| InChIKey | MGNXKFWQSIQQTO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |