About 1,4-diazepane;isoquinoline-5-sulfonyl chloride
1,4-diazepane;isoquinoline-5-sulfonyl chloride (PubChem CID 175135065) has the molecular formula C14H18ClN3O2S
and a molecular weight of 327.84 g/mol. Its IUPAC name is 1,4-diazepane;isoquinoline-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 1,4-diazepane;isoquinoline-5-sulfonyl chloride |
| PubChem CID | 175135065 |
| Molecular Formula | C14H18ClN3O2S |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 1,4-diazepane;isoquinoline-5-sulfonyl chloride |
| SMILES | C1CNCCNC1.O=S(=O)(Cl)c1cccc2cnccc12 |
| InChI | InChI=1S/C9H6ClNO2S.C5H12N2/c10-14(12,13)9-3-1-2-7-6-11-5-4-8(7)9;1-2-6-4-5-7-3-1/h1-6H;6-7H,1-5H2 |
| InChIKey | SDGFHIYYKMOUER-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,4-diazepane;isoquinoline-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diazepane;isoquinoline-5-sulfonyl chloride?
The IUPAC name of 1,4-diazepane;isoquinoline-5-sulfonyl chloride (CID 175135065) is 1,4-diazepane;isoquinoline-5-sulfonyl chloride.
What is the SMILES notation for 1,4-diazepane;isoquinoline-5-sulfonyl chloride?
The canonical SMILES for 1,4-diazepane;isoquinoline-5-sulfonyl chloride is C1CNCCNC1.O=S(=O)(Cl)c1cccc2cnccc12.
What is the InChIKey of 1,4-diazepane;isoquinoline-5-sulfonyl chloride?
The InChIKey is SDGFHIYYKMOUER-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO2S.C5H12N2/c10-14(12,13)9-3-1-2-7-6-11-5-4-8(7)9;1-2-6-4-5-7-3-1/h1-6H;6-7H,1-5H2.
What are the key properties of 1,4-diazepane;isoquinoline-5-sulfonyl chloride?
1,4-diazepane;isoquinoline-5-sulfonyl chloride has a molecular weight of 327.84 g/mol, XLogP of 1.73, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diazepane;isoquinoline-5-sulfonyl chloride is sourced from PubChem (CID 175135065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).