C14H18ClN3O2S — CID 175135065
1,4-diazepane;isoquinoline-5-sulfonyl chloride (PubChem CID 175135065) has the molecular formula C14H18ClN3O2S and a molecular weight of 327.84 g/mol. Its IUPAC name is 1,4-diazepane;isoquinoline-5-sulfonyl chloride.
| Compound Name | 1,4-diazepane;isoquinoline-5-sulfonyl chloride |
|---|---|
| PubChem CID | 175135065 |
| Molecular Formula | C14H18ClN3O2S |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 1,4-diazepane;isoquinoline-5-sulfonyl chloride |
| SMILES | C1CNCCNC1.O=S(=O)(Cl)c1cccc2cnccc12 |
| InChI | InChI=1S/C9H6ClNO2S.C5H12N2/c10-14(12,13)9-3-1-2-7-6-11-5-4-8(7)9;1-2-6-4-5-7-3-1/h1-6H;6-7H,1-5H2 |
| InChIKey | SDGFHIYYKMOUER-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |