C17H23N3O3S — CID 99816349
N-[[(2S)-1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]isoquinoline-5-sulfonamide (PubChem CID 99816349) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-[[(2S)-1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]isoquinoline-5-sulfonamide.
| Compound Name | N-[[(2S)-1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 99816349 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[[(2S)-1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]isoquinoline-5-sulfonamide |
| SMILES | COCCN1CCC[C@H]1CNS(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C17H23N3O3S/c1-23-11-10-20-9-3-5-15(20)13-19-24(21,22)17-6-2-4-14-12-18-8-7-16(14)17/h2,4,6-8,12,15,19H,3,5,9-11,13H2,1H3/t15-/m0/s1 |
| InChIKey | XQTGCSWGPLHNNH-HNNXBMFYSA-N |
| XLogP | 1.62 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |