C19H20ClN3O3S — CID 139744416
8-chloro-N-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]quinoline-5-sulfonamide (PubChem CID 139744416) has the molecular formula C19H20ClN3O3S and a molecular weight of 405.91 g/mol. Its IUPAC name is 8-chloro-N-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]quinoline-5-sulfonamide.
| Compound Name | 8-chloro-N-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 139744416 |
| Molecular Formula | C19H20ClN3O3S |
| Molecular Weight | 405.91 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 8-chloro-N-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]quinoline-5-sulfonamide |
| SMILES | O=S(=O)(NCCNCC(O)c1ccccc1)c1ccc(Cl)c2ncccc12 |
| InChI | InChI=1S/C19H20ClN3O3S/c20-16-8-9-18(15-7-4-10-22-19(15)16)27(25,26)23-12-11-21-13-17(24)14-5-2-1-3-6-14/h1-10,17,21,23-24H,11-13H2 |
| InChIKey | MJFKJHADNUTGOO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.91 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|