C21H17ClN2O3S — CID 166326565
4-chloro-N-(2-hydroxy-2-naphthalen-1-ylethyl)quinoline-8-sulfonamide (PubChem CID 166326565) has the molecular formula C21H17ClN2O3S and a molecular weight of 412.90 g/mol. Its IUPAC name is 4-chloro-N-(2-hydroxy-2-naphthalen-1-ylethyl)quinoline-8-sulfonamide.
| Compound Name | 4-chloro-N-(2-hydroxy-2-naphthalen-1-ylethyl)quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 166326565 |
| Molecular Formula | C21H17ClN2O3S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 4-chloro-N-(2-hydroxy-2-naphthalen-1-ylethyl)quinoline-8-sulfonamide |
| SMILES | O=S(=O)(NCC(O)c1cccc2ccccc12)c1cccc2c(Cl)ccnc12 |
| InChI | InChI=1S/C21H17ClN2O3S/c22-18-11-12-23-21-17(18)9-4-10-20(21)28(26,27)24-13-19(25)16-8-3-6-14-5-1-2-7-15(14)16/h1-12,19,24-25H,13H2 |
| InChIKey | VKDIPMBTZSLPEN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |