C17H15ClN2O3S — CID 166423420
6-chloro-N-(2-hydroxy-2-naphthalen-1-ylethyl)pyridine-3-sulfonamide (PubChem CID 166423420) has the molecular formula C17H15ClN2O3S and a molecular weight of 362.84 g/mol. Its IUPAC name is 6-chloro-N-(2-hydroxy-2-naphthalen-1-ylethyl)pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-(2-hydroxy-2-naphthalen-1-ylethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 166423420 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 6-chloro-N-(2-hydroxy-2-naphthalen-1-ylethyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCC(O)c1cccc2ccccc12)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C17H15ClN2O3S/c18-17-9-8-13(10-19-17)24(22,23)20-11-16(21)15-7-3-5-12-4-1-2-6-14(12)15/h1-10,16,20-21H,11H2 |
| InChIKey | HKEYBCQJKVXCER-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|