C17H24Cl3N3O2S — CID 119994715
4-chloro-N-(3-piperazin-1-ylpropyl)naphthalene-1-sulfonamide;dihydrochloride (PubChem CID 119994715) has the molecular formula C17H24Cl3N3O2S and a molecular weight of 440.82 g/mol. Its IUPAC name is 4-chloro-N-(3-piperazin-1-ylpropyl)naphthalene-1-sulfonamide;dihydrochloride.
| Compound Name | 4-chloro-N-(3-piperazin-1-ylpropyl)naphthalene-1-sulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 119994715 |
| Molecular Formula | C17H24Cl3N3O2S |
| Molecular Weight | 440.82 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | 4-chloro-N-(3-piperazin-1-ylpropyl)naphthalene-1-sulfonamide;dihydrochloride |
| SMILES | Cl.Cl.O=S(=O)(NCCCN1CCNCC1)c1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C17H22ClN3O2S.2ClH/c18-16-6-7-17(15-5-2-1-4-14(15)16)24(22,23)20-8-3-11-21-12-9-19-10-13-21;;/h1-2,4-7,19-20H,3,8-13H2;2*1H |
| InChIKey | YEQXPXAPZPCYJD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.82 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|