C16H20N2O4S — CID 136533052
3-methyl-2-[[(2-methylquinolin-8-yl)sulfonylamino]methyl]butanoic acid (PubChem CID 136533052) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 3-methyl-2-[[(2-methylquinolin-8-yl)sulfonylamino]methyl]butanoic acid.
| Compound Name | 3-methyl-2-[[(2-methylquinolin-8-yl)sulfonylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 136533052 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-methyl-2-[[(2-methylquinolin-8-yl)sulfonylamino]methyl]butanoic acid |
| SMILES | Cc1ccc2cccc(S(=O)(=O)NCC(C(=O)O)C(C)C)c2n1 |
| InChI | InChI=1S/C16H20N2O4S/c1-10(2)13(16(19)20)9-17-23(21,22)14-6-4-5-12-8-7-11(3)18-15(12)14/h4-8,10,13,17H,9H2,1-3H3,(H,19,20) |
| InChIKey | LIAGIBUACCFPPP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |