C18H24ClNO2S — CID 24891141
N-(1-adamantylmethyl)-3-chloro-2-methylbenzenesulfonamide (PubChem CID 24891141) has the molecular formula C18H24ClNO2S and a molecular weight of 353.92 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-3-chloro-2-methylbenzenesulfonamide.
| Compound Name | N-(1-adamantylmethyl)-3-chloro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 24891141 |
| Molecular Formula | C18H24ClNO2S |
| Molecular Weight | 353.92 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-(1-adamantylmethyl)-3-chloro-2-methylbenzenesulfonamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H24ClNO2S/c1-12-16(19)3-2-4-17(12)23(21,22)20-11-18-8-13-5-14(9-18)7-15(6-13)10-18/h2-4,13-15,20H,5-11H2,1H3 |
| InChIKey | VHORNQRXBHLRBN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.92 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |