C21H31NO2S — CID 7937592
N-(1-adamantylmethyl)-2,3,5,6-tetramethylbenzenesulfonamide (PubChem CID 7937592) has the molecular formula C21H31NO2S and a molecular weight of 361.55 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2,3,5,6-tetramethylbenzenesulfonamide.
| Compound Name | N-(1-adamantylmethyl)-2,3,5,6-tetramethylbenzenesulfonamide |
|---|---|
| PubChem CID | 7937592 |
| Molecular Formula | C21H31NO2S |
| Molecular Weight | 361.55 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | N-(1-adamantylmethyl)-2,3,5,6-tetramethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)NCC23CC4CC(CC(C4)C2)C3)c1C |
| InChI | InChI=1S/C21H31NO2S/c1-13-5-14(2)16(4)20(15(13)3)25(23,24)22-12-21-9-17-6-18(10-21)8-19(7-17)11-21/h5,17-19,22H,6-12H2,1-4H3 |
| InChIKey | AVKSFGUCWGRANI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |