C21H24ClNO2S — CID 54571729
N-(1-adamantylmethyl)-5-chloronaphthalene-2-sulfonamide (PubChem CID 54571729) has the molecular formula C21H24ClNO2S and a molecular weight of 389.95 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-5-chloronaphthalene-2-sulfonamide.
| Compound Name | N-(1-adamantylmethyl)-5-chloronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 54571729 |
| Molecular Formula | C21H24ClNO2S |
| Molecular Weight | 389.95 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-(1-adamantylmethyl)-5-chloronaphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCC12CC3CC(CC(C3)C1)C2)c1ccc2c(Cl)cccc2c1 |
| InChI | InChI=1S/C21H24ClNO2S/c22-20-3-1-2-17-9-18(4-5-19(17)20)26(24,25)23-13-21-10-14-6-15(11-21)8-16(7-14)12-21/h1-5,9,14-16,23H,6-8,10-13H2 |
| InChIKey | ZXTOZNJVMWODKO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.95 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |