C19H24Cl2N2O3S — CID 4840253
N-(1-adamantylmethyl)-2-[(3,4-dichlorophenyl)sulfonylamino]acetamide (PubChem CID 4840253) has the molecular formula C19H24Cl2N2O3S and a molecular weight of 431.39 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-[(3,4-dichlorophenyl)sulfonylamino]acetamide.
| Compound Name | N-(1-adamantylmethyl)-2-[(3,4-dichlorophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 4840253 |
| Molecular Formula | C19H24Cl2N2O3S |
| Molecular Weight | 431.39 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | N-(1-adamantylmethyl)-2-[(3,4-dichlorophenyl)sulfonylamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(Cl)c(Cl)c1)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H24Cl2N2O3S/c20-16-2-1-15(6-17(16)21)27(25,26)23-10-18(24)22-11-19-7-12-3-13(8-19)5-14(4-12)9-19/h1-2,6,12-14,23H,3-5,7-11H2,(H,22,24) |
| InChIKey | XLMZFVBCDFOROE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |