C19H22ClNO3 — CID 18381486
3-(1-adamantylmethylcarbamoyl)-4-chlorobenzoic acid (PubChem CID 18381486) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is 3-(1-adamantylmethylcarbamoyl)-4-chlorobenzoic acid.
| Compound Name | 3-(1-adamantylmethylcarbamoyl)-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 18381486 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 3-(1-adamantylmethylcarbamoyl)-4-chlorobenzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(C(=O)NCC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C19H22ClNO3/c20-16-2-1-14(18(23)24)6-15(16)17(22)21-10-19-7-11-3-12(8-19)5-13(4-11)9-19/h1-2,6,11-13H,3-5,7-10H2,(H,21,22)(H,23,24) |
| InChIKey | CCHVPTHYTJIYSK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |