C25H27ClN2O3 — CID 11539417
3-[3-(1-adamantylmethylcarbamoyl)-4-chlorophenyl]-6-methylpyridine-2-carboxylic acid (PubChem CID 11539417) has the molecular formula C25H27ClN2O3 and a molecular weight of 438.96 g/mol. Its IUPAC name is 3-[3-(1-adamantylmethylcarbamoyl)-4-chlorophenyl]-6-methylpyridine-2-carboxylic acid.
| Compound Name | 3-[3-(1-adamantylmethylcarbamoyl)-4-chlorophenyl]-6-methylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 11539417 |
| Molecular Formula | C25H27ClN2O3 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3-[3-(1-adamantylmethylcarbamoyl)-4-chlorophenyl]-6-methylpyridine-2-carboxylic acid |
| SMILES | Cc1ccc(-c2ccc(Cl)c(C(=O)NCC34CC5CC(CC(C5)C3)C4)c2)c(C(=O)O)n1 |
| InChI | InChI=1S/C25H27ClN2O3/c1-14-2-4-19(22(28-14)24(30)31)18-3-5-21(26)20(9-18)23(29)27-13-25-10-15-6-16(11-25)8-17(7-15)12-25/h2-5,9,15-17H,6-8,10-13H2,1H3,(H,27,29)(H,30,31) |
| InChIKey | WMLBJULNOIUERE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |