C28H27ClN2O3 — CID 11503827
3-[5-(1-adamantylmethylcarbamoyl)-6-chloroquinolin-2-yl]benzoic acid (PubChem CID 11503827) has the molecular formula C28H27ClN2O3 and a molecular weight of 474.99 g/mol. Its IUPAC name is 3-[5-(1-adamantylmethylcarbamoyl)-6-chloroquinolin-2-yl]benzoic acid.
| Compound Name | 3-[5-(1-adamantylmethylcarbamoyl)-6-chloroquinolin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 11503827 |
| Molecular Formula | C28H27ClN2O3 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 3-[5-(1-adamantylmethylcarbamoyl)-6-chloroquinolin-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2ccc3c(C(=O)NCC45CC6CC(CC(C6)C4)C5)c(Cl)ccc3n2)c1 |
| InChI | InChI=1S/C28H27ClN2O3/c29-22-5-7-24-21(4-6-23(31-24)19-2-1-3-20(11-19)27(33)34)25(22)26(32)30-15-28-12-16-8-17(13-28)10-18(9-16)14-28/h1-7,11,16-18H,8-10,12-15H2,(H,30,32)(H,33,34) |
| InChIKey | VEXQDRCYDJOVGB-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |