C19H22F3NO — CID 4553132
N-(1-adamantylmethyl)-3-(trifluoromethyl)benzamide (PubChem CID 4553132) has the molecular formula C19H22F3NO and a molecular weight of 337.38 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(1-adamantylmethyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 4553132 |
| Molecular Formula | C19H22F3NO |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | N-(1-adamantylmethyl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H22F3NO/c20-19(21,22)16-3-1-2-15(7-16)17(24)23-11-18-8-12-4-13(9-18)6-14(5-12)10-18/h1-3,7,12-14H,4-6,8-11H2,(H,23,24) |
| InChIKey | JPIOPBKEVLUKST-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |