C18H21F3N2O — CID 134093435
N'-(1-adamantyl)-3-(trifluoromethyl)benzohydrazide (PubChem CID 134093435) has the molecular formula C18H21F3N2O and a molecular weight of 338.37 g/mol. Its IUPAC name is N'-(1-adamantyl)-3-(trifluoromethyl)benzohydrazide.
| Compound Name | N'-(1-adamantyl)-3-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 134093435 |
| Molecular Formula | C18H21F3N2O |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N'-(1-adamantyl)-3-(trifluoromethyl)benzohydrazide |
| SMILES | O=C(NNC12CC3CC(CC(C3)C1)C2)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H21F3N2O/c19-18(20,21)15-3-1-2-14(7-15)16(24)22-23-17-8-11-4-12(9-17)6-13(5-11)10-17/h1-3,7,11-13,23H,4-6,8-10H2,(H,22,24) |
| InChIKey | RHPDTQGYVBIBGH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|