C20H25F3N2O — CID 164626898
N'-[1-(1-adamantyl)ethyl]-4-(trifluoromethyl)benzohydrazide (PubChem CID 164626898) has the molecular formula C20H25F3N2O and a molecular weight of 366.43 g/mol. Its IUPAC name is N'-[1-(1-adamantyl)ethyl]-4-(trifluoromethyl)benzohydrazide.
| Compound Name | N'-[1-(1-adamantyl)ethyl]-4-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 164626898 |
| Molecular Formula | C20H25F3N2O |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N'-[1-(1-adamantyl)ethyl]-4-(trifluoromethyl)benzohydrazide |
| SMILES | CC(NNC(=O)c1ccc(C(F)(F)F)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H25F3N2O/c1-12(19-9-13-6-14(10-19)8-15(7-13)11-19)24-25-18(26)16-2-4-17(5-3-16)20(21,22)23/h2-5,12-15,24H,6-11H2,1H3,(H,25,26) |
| InChIKey | VVBVERYXPHOGOU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|