C20H24F3NO — CID 37354931
N-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]adamantane-1-carboxamide (PubChem CID 37354931) has the molecular formula C20H24F3NO and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]adamantane-1-carboxamide.
| Compound Name | N-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 37354931 |
| Molecular Formula | C20H24F3NO |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | N-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]adamantane-1-carboxamide |
| SMILES | C[C@H](NC(=O)C12CC3CC(CC(C3)C1)C2)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H24F3NO/c1-12(16-2-4-17(5-3-16)20(21,22)23)24-18(25)19-9-13-6-14(10-19)8-15(7-13)11-19/h2-5,12-15H,6-11H2,1H3,(H,24,25)/t12-,13?,14?,15?,19?/m0/s1 |
| InChIKey | UDTHOBDBLQFGDB-UHSVVUDUSA-N |
| XLogP | 5.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |