C23H29F3N2O2 — CID 16557098
N-[3-oxo-3-[1-[3-(trifluoromethyl)phenyl]ethylamino]propyl]adamantane-1-carboxamide (PubChem CID 16557098) has the molecular formula C23H29F3N2O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[3-oxo-3-[1-[3-(trifluoromethyl)phenyl]ethylamino]propyl]adamantane-1-carboxamide.
| Compound Name | N-[3-oxo-3-[1-[3-(trifluoromethyl)phenyl]ethylamino]propyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 16557098 |
| Molecular Formula | C23H29F3N2O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-[3-oxo-3-[1-[3-(trifluoromethyl)phenyl]ethylamino]propyl]adamantane-1-carboxamide |
| SMILES | CC(NC(=O)CCNC(=O)C12CC3CC(CC(C3)C1)C2)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H29F3N2O2/c1-14(18-3-2-4-19(10-18)23(24,25)26)28-20(29)5-6-27-21(30)22-11-15-7-16(12-22)9-17(8-15)13-22/h2-4,10,14-17H,5-9,11-13H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | LVMRWSGMFIMUCJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |