C26H35ClN4O — CID 10288420
N-(1-adamantylmethyl)-6-chloro-2-[methyl-[3-(methylamino)propyl]amino]quinoline-5-carboxamide (PubChem CID 10288420) has the molecular formula C26H35ClN4O and a molecular weight of 455.05 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-6-chloro-2-[methyl-[3-(methylamino)propyl]amino]quinoline-5-carboxamide.
| Compound Name | N-(1-adamantylmethyl)-6-chloro-2-[methyl-[3-(methylamino)propyl]amino]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 10288420 |
| Molecular Formula | C26H35ClN4O |
| Molecular Weight | 455.05 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | N-(1-adamantylmethyl)-6-chloro-2-[methyl-[3-(methylamino)propyl]amino]quinoline-5-carboxamide |
| SMILES | CNCCCN(C)c1ccc2c(C(=O)NCC34CC5CC(CC(C5)C3)C4)c(Cl)ccc2n1 |
| InChI | InChI=1S/C26H35ClN4O/c1-28-8-3-9-31(2)23-7-4-20-22(30-23)6-5-21(27)24(20)25(32)29-16-26-13-17-10-18(14-26)12-19(11-17)15-26/h4-7,17-19,28H,3,8-16H2,1-2H3,(H,29,32) |
| InChIKey | VYNPMMSKGWCEGI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.05 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|