C24H34ClNO4S — CID 10183534
N-(1-adamantylmethyl)-2-chloro-5-[3-(3-hydroxypropylsulfinyl)propoxy]benzamide (PubChem CID 10183534) has the molecular formula C24H34ClNO4S and a molecular weight of 468.06 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-chloro-5-[3-(3-hydroxypropylsulfinyl)propoxy]benzamide.
| Compound Name | N-(1-adamantylmethyl)-2-chloro-5-[3-(3-hydroxypropylsulfinyl)propoxy]benzamide |
|---|---|
| PubChem CID | 10183534 |
| Molecular Formula | C24H34ClNO4S |
| Molecular Weight | 468.06 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N-(1-adamantylmethyl)-2-chloro-5-[3-(3-hydroxypropylsulfinyl)propoxy]benzamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)c1cc(OCCCS(=O)CCCO)ccc1Cl |
| InChI | InChI=1S/C24H34ClNO4S/c25-22-4-3-20(30-6-2-8-31(29)7-1-5-27)12-21(22)23(28)26-16-24-13-17-9-18(14-24)11-19(10-17)15-24/h3-4,12,17-19,27H,1-2,5-11,13-16H2,(H,26,28) |
| InChIKey | DTZXUPTXDJJGSA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.06 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|