C22H32Cl2N2O2S — CID 10276272
N-(1-adamantylmethyl)-5-[2-(2-aminoethylsulfanyl)ethoxy]-2-chlorobenzamide;hydrochloride (PubChem CID 10276272) has the molecular formula C22H32Cl2N2O2S and a molecular weight of 459.48 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-5-[2-(2-aminoethylsulfanyl)ethoxy]-2-chlorobenzamide;hydrochloride.
| Compound Name | N-(1-adamantylmethyl)-5-[2-(2-aminoethylsulfanyl)ethoxy]-2-chlorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 10276272 |
| Molecular Formula | C22H32Cl2N2O2S |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N-(1-adamantylmethyl)-5-[2-(2-aminoethylsulfanyl)ethoxy]-2-chlorobenzamide;hydrochloride |
| SMILES | Cl.NCCSCCOc1ccc(Cl)c(C(=O)NCC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C22H31ClN2O2S.ClH/c23-20-2-1-18(27-4-6-28-5-3-24)10-19(20)21(26)25-14-22-11-15-7-16(12-22)9-17(8-15)13-22;/h1-2,10,15-17H,3-9,11-14,24H2,(H,25,26);1H |
| InChIKey | PIIGEBYWRSCSJD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|