C25H35ClN2O2 — CID 18336920
N-(1-adamantylmethyl)-2-chloro-5-(2-piperidin-4-ylethoxy)benzamide (PubChem CID 18336920) has the molecular formula C25H35ClN2O2 and a molecular weight of 431.02 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-chloro-5-(2-piperidin-4-ylethoxy)benzamide.
| Compound Name | N-(1-adamantylmethyl)-2-chloro-5-(2-piperidin-4-ylethoxy)benzamide |
|---|---|
| PubChem CID | 18336920 |
| Molecular Formula | C25H35ClN2O2 |
| Molecular Weight | 431.02 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | N-(1-adamantylmethyl)-2-chloro-5-(2-piperidin-4-ylethoxy)benzamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)c1cc(OCCC2CCNCC2)ccc1Cl |
| InChI | InChI=1S/C25H35ClN2O2/c26-23-2-1-21(30-8-5-17-3-6-27-7-4-17)12-22(23)24(29)28-16-25-13-18-9-19(14-25)11-20(10-18)15-25/h1-2,12,17-20,27H,3-11,13-16H2,(H,28,29) |
| InChIKey | HLVAQWDPUSCIEP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.02 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |