C23H33ClN2O3 — CID 21107382
N-(1-adamantylmethyl)-2-chloro-5-[(1R)-1-hydroxy-2-(3-hydroxypropylamino)ethyl]benzamide (PubChem CID 21107382) has the molecular formula C23H33ClN2O3 and a molecular weight of 420.98 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-chloro-5-[(1R)-1-hydroxy-2-(3-hydroxypropylamino)ethyl]benzamide.
| Compound Name | N-(1-adamantylmethyl)-2-chloro-5-[(1R)-1-hydroxy-2-(3-hydroxypropylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 21107382 |
| Molecular Formula | C23H33ClN2O3 |
| Molecular Weight | 420.98 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | N-(1-adamantylmethyl)-2-chloro-5-[(1R)-1-hydroxy-2-(3-hydroxypropylamino)ethyl]benzamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)c1cc([C@@H](O)CNCCCO)ccc1Cl |
| InChI | InChI=1S/C23H33ClN2O3/c24-20-3-2-18(21(28)13-25-4-1-5-27)9-19(20)22(29)26-14-23-10-15-6-16(11-23)8-17(7-15)12-23/h2-3,9,15-17,21,25,27-28H,1,4-8,10-14H2,(H,26,29)/t15?,16?,17?,21-,23?/m0/s1 |
| InChIKey | KCYXLWUEYIEMCV-RWENRRORSA-N |
| XLogP | 3.29 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.98 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|