C22H29ClN2O2 — CID 142935591
2-chloro-5-[(1R)-1-hydroxy-2-(methylamino)ethyl]-N-[(5-methyl-5-tricyclo[5.2.1.03,9]dec-3-enyl)methyl]benzamide (PubChem CID 142935591) has the molecular formula C22H29ClN2O2 and a molecular weight of 388.94 g/mol. Its IUPAC name is 2-chloro-5-[(1R)-1-hydroxy-2-(methylamino)ethyl]-N-[(5-methyl-5-tricyclo[5.2.1.03,9]dec-3-enyl)methyl]benzamide.
| Compound Name | 2-chloro-5-[(1R)-1-hydroxy-2-(methylamino)ethyl]-N-[(5-methyl-5-tricyclo[5.2.1.03,9]dec-3-enyl)methyl]benzamide |
|---|---|
| PubChem CID | 142935591 |
| Molecular Formula | C22H29ClN2O2 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-chloro-5-[(1R)-1-hydroxy-2-(methylamino)ethyl]-N-[(5-methyl-5-tricyclo[5.2.1.03,9]dec-3-enyl)methyl]benzamide |
| SMILES | CNC[C@H](O)c1ccc(Cl)c(C(=O)NCC2(C)C=C3CC4CC(CC34)C2)c1 |
| InChI | InChI=1S/C22H29ClN2O2/c1-22(9-13-5-15-7-16(10-22)17(15)6-13)12-25-21(27)18-8-14(3-4-19(18)23)20(26)11-24-2/h3-4,8,10,13,15,17,20,24,26H,5-7,9,11-12H2,1-2H3,(H,25,27)/t13?,15?,17?,20-,22?/m0/s1 |
| InChIKey | CJRORRGUNMFVHI-LFWNCBLTSA-N |
| XLogP | 3.71 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|