C25H33ClN2O — CID 142022293
2-chloro-N-[(5-methyl-5-tricyclo[5.2.1.03,9]dec-3-enyl)methyl]-5-(piperidin-4-ylmethyl)benzamide (PubChem CID 142022293) has the molecular formula C25H33ClN2O and a molecular weight of 413.01 g/mol. Its IUPAC name is 2-chloro-N-[(5-methyl-5-tricyclo[5.2.1.03,9]dec-3-enyl)methyl]-5-(piperidin-4-ylmethyl)benzamide.
| Compound Name | 2-chloro-N-[(5-methyl-5-tricyclo[5.2.1.03,9]dec-3-enyl)methyl]-5-(piperidin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 142022293 |
| Molecular Formula | C25H33ClN2O |
| Molecular Weight | 413.01 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 2-chloro-N-[(5-methyl-5-tricyclo[5.2.1.03,9]dec-3-enyl)methyl]-5-(piperidin-4-ylmethyl)benzamide |
| SMILES | CC1(CNC(=O)c2cc(CC3CCNCC3)ccc2Cl)C=C2CC3CC(CC23)C1 |
| InChI | InChI=1S/C25H33ClN2O/c1-25(13-18-9-19-12-20(14-25)21(19)11-18)15-28-24(29)22-10-17(2-3-23(22)26)8-16-4-6-27-7-5-16/h2-3,10,14,16,18-19,21,27H,4-9,11-13,15H2,1H3,(H,28,29) |
| InChIKey | FQEFLWCALITYQS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.01 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|