C25H35ClN2O2 — CID 142935593
2-chloro-5-[(3S)-4-(ethylamino)-3-hydroxybutyl]-N-[(5-methyl-5-tricyclo[5.2.1.03,9]dec-3-enyl)methyl]benzamide (PubChem CID 142935593) has the molecular formula C25H35ClN2O2 and a molecular weight of 431.02 g/mol. Its IUPAC name is 2-chloro-5-[(3S)-4-(ethylamino)-3-hydroxybutyl]-N-[(5-methyl-5-tricyclo[5.2.1.03,9]dec-3-enyl)methyl]benzamide.
| Compound Name | 2-chloro-5-[(3S)-4-(ethylamino)-3-hydroxybutyl]-N-[(5-methyl-5-tricyclo[5.2.1.03,9]dec-3-enyl)methyl]benzamide |
|---|---|
| PubChem CID | 142935593 |
| Molecular Formula | C25H35ClN2O2 |
| Molecular Weight | 431.02 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 2-chloro-5-[(3S)-4-(ethylamino)-3-hydroxybutyl]-N-[(5-methyl-5-tricyclo[5.2.1.03,9]dec-3-enyl)methyl]benzamide |
| SMILES | CCNC[C@@H](O)CCc1ccc(Cl)c(C(=O)NCC2(C)C=C3CC4CC(CC34)C2)c1 |
| InChI | InChI=1S/C25H35ClN2O2/c1-3-27-14-20(29)6-4-16-5-7-23(26)22(9-16)24(30)28-15-25(2)12-17-8-18-11-19(13-25)21(18)10-17/h5,7,9,13,17-18,20-21,27,29H,3-4,6,8,10-12,14-15H2,1-2H3,(H,28,30)/t17?,18?,20-,21?,25?/m0/s1 |
| InChIKey | FMEBMMCJKZMOBO-VVKLAPRVSA-N |
| XLogP | 4.36 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.02 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|