C23H32ClFN2O — CID 10136060
N-(1-adamantylmethyl)-2-chloro-5-[3-(2-fluoroethylamino)propyl]benzamide (PubChem CID 10136060) has the molecular formula C23H32ClFN2O and a molecular weight of 406.97 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-chloro-5-[3-(2-fluoroethylamino)propyl]benzamide.
| Compound Name | N-(1-adamantylmethyl)-2-chloro-5-[3-(2-fluoroethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 10136060 |
| Molecular Formula | C23H32ClFN2O |
| Molecular Weight | 406.97 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | N-(1-adamantylmethyl)-2-chloro-5-[3-(2-fluoroethylamino)propyl]benzamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)c1cc(CCCNCCF)ccc1Cl |
| InChI | InChI=1S/C23H32ClFN2O/c24-21-4-3-16(2-1-6-26-7-5-25)11-20(21)22(28)27-15-23-12-17-8-18(13-23)10-19(9-17)14-23/h3-4,11,17-19,26H,1-2,5-10,12-15H2,(H,27,28) |
| InChIKey | MFIRMJHOXBXAHI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.97 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|