C25H36ClN3O — CID 18381571
N-(1-adamantylmethyl)-5-[2-(4-aminopiperidin-1-yl)ethyl]-2-chlorobenzamide (PubChem CID 18381571) has the molecular formula C25H36ClN3O and a molecular weight of 430.04 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-5-[2-(4-aminopiperidin-1-yl)ethyl]-2-chlorobenzamide.
| Compound Name | N-(1-adamantylmethyl)-5-[2-(4-aminopiperidin-1-yl)ethyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 18381571 |
| Molecular Formula | C25H36ClN3O |
| Molecular Weight | 430.04 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | N-(1-adamantylmethyl)-5-[2-(4-aminopiperidin-1-yl)ethyl]-2-chlorobenzamide |
| SMILES | NC1CCN(CCc2ccc(Cl)c(C(=O)NCC34CC5CC(CC(C5)C3)C4)c2)CC1 |
| InChI | InChI=1S/C25H36ClN3O/c26-23-2-1-17(3-6-29-7-4-21(27)5-8-29)12-22(23)24(30)28-16-25-13-18-9-19(14-25)11-20(10-18)15-25/h1-2,12,18-21H,3-11,13-16,27H2,(H,28,30) |
| InChIKey | PJZHXNLMVZMWGN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.04 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |